C12H10N4 — CID 12726814
3-methyl-6-phenyl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 12726814) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-methyl-6-phenyl-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-methyl-6-phenyl-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 12726814 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-methyl-6-phenyl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cc1nnc2ccc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C12H10N4/c1-9-13-14-12-8-7-11(15-16(9)12)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | OAVPGZZEIGFNCJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |