C11H10Cl2O2 — CID 12727221
10,11-dichloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one (PubChem CID 12727221) has the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. Its IUPAC name is 10,11-dichloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one.
| Compound Name | 10,11-dichloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one |
|---|---|
| PubChem CID | 12727221 |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.10 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 10,11-dichloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one |
| SMILES | O=C1C2CC3OC4C(C=C(Cl)C(Cl)C24)C13 |
| InChI | InChI=1S/C11H10Cl2O2/c12-5-1-4-7-6-2-3(10(7)14)8(9(5)13)11(4)15-6/h1,3-4,6-9,11H,2H2 |
| InChIKey | VZWVFTZGCLDTFD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|