About 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one
11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one (PubChem CID 12727247) has the molecular formula C11H11ClO2
and a molecular weight of 210.66 g/mol. Its IUPAC name is 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one.
Analyze 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one?
The IUPAC name of 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one (CID 12727247) is 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one.
What is the SMILES notation for 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one?
The canonical SMILES for 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one is O=C1C2CC3OC4C(C=C(Cl)CC24)C13.
What is the InChIKey of 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one?
The InChIKey is VNELMVKTJDSLMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO2/c12-4-1-6-5-3-8-9(10(5)13)7(2-4)11(6)14-8/h2,5-9,11H,1,3H2.
What are the key properties of 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one?
11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one has a molecular weight of 210.66 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-chloro-7-oxatetracyclo[6.4.0.02,6.04,9]dodec-11-en-3-one is sourced from PubChem (CID 12727247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).