C11H11ClO2 — CID 539506
11-chloro-8-methyl-9-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-2-one (PubChem CID 539506) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 11-chloro-8-methyl-9-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-2-one.
| Compound Name | 11-chloro-8-methyl-9-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-2-one |
|---|---|
| PubChem CID | 539506 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 11-chloro-8-methyl-9-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-2-one |
| SMILES | CC12OC3C(Cl)C4C(=O)C3C1C=CC42 |
| InChI | InChI=1S/C11H11ClO2/c1-11-4-2-3-5(11)7-9(13)6(4)8(12)10(7)14-11/h2-8,10H,1H3 |
| InChIKey | MKEAOSGXJQUVDU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|