C18H38NO+ — CID 12727808
decyl-(3,3-dimethyl-2-oxobutyl)-dimethylazanium (PubChem CID 12727808) has the molecular formula C18H38NO+ and a molecular weight of 284.51 g/mol. Its IUPAC name is decyl-(3,3-dimethyl-2-oxobutyl)-dimethylazanium.
| Compound Name | decyl-(3,3-dimethyl-2-oxobutyl)-dimethylazanium |
|---|---|
| PubChem CID | 12727808 |
| Molecular Formula | C18H38NO+ |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | decyl-(3,3-dimethyl-2-oxobutyl)-dimethylazanium |
| SMILES | CCCCCCCCCC[N+](C)(C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H38NO/c1-7-8-9-10-11-12-13-14-15-19(5,6)16-17(20)18(2,3)4/h7-16H2,1-6H3/q+1 |
| InChIKey | WETQADICLSKUAJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|