C18H16ClN3OS — CID 1272930
(2S)-2-(2-chloro-1H-indol-3-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 1272930) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is (2S)-2-(2-chloro-1H-indol-3-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S)-2-(2-chloro-1H-indol-3-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 1272930 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (2S)-2-(2-chloro-1H-indol-3-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C1N[C@H](c2c(Cl)[nH]c3ccccc23)Nc2sc3c(c21)CCCC3 |
| InChI | InChI=1S/C18H16ClN3OS/c19-15-13(9-5-1-3-7-11(9)20-15)16-21-17(23)14-10-6-2-4-8-12(10)24-18(14)22-16/h1,3,5,7,16,20,22H,2,4,6,8H2,(H,21,23)/t16-/m0/s1 |
| InChIKey | RZPBKRHDOJRQPO-INIZCTEOSA-N |
| XLogP | 4.62 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |