C11H14N2OS2 — CID 139214508
5-sulfanyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7)-dien-3-one (PubChem CID 139214508) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 5-sulfanyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7)-dien-3-one.
| Compound Name | 5-sulfanyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 139214508 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 5-sulfanyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7)-dien-3-one |
| SMILES | O=C1NC(S)Nc2sc3c(c21)CCCCC3 |
| InChI | InChI=1S/C11H14N2OS2/c14-9-8-6-4-2-1-3-5-7(6)16-10(8)13-11(15)12-9/h11,13,15H,1-5H2,(H,12,14) |
| InChIKey | WQMIUSVRLOXOST-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|