C33H29NO2 — CID 12729552
N-(4-methoxy-1-methyl-2,4,6-triphenylcyclohexa-2,5-dien-1-yl)benzamide (PubChem CID 12729552) has the molecular formula C33H29NO2 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-(4-methoxy-1-methyl-2,4,6-triphenylcyclohexa-2,5-dien-1-yl)benzamide.
| Compound Name | N-(4-methoxy-1-methyl-2,4,6-triphenylcyclohexa-2,5-dien-1-yl)benzamide |
|---|---|
| PubChem CID | 12729552 |
| Molecular Formula | C33H29NO2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-(4-methoxy-1-methyl-2,4,6-triphenylcyclohexa-2,5-dien-1-yl)benzamide |
| SMILES | COC1(c2ccccc2)C=C(c2ccccc2)C(C)(NC(=O)c2ccccc2)C(c2ccccc2)=C1 |
| InChI | InChI=1S/C33H29NO2/c1-32(34-31(35)27-19-11-5-12-20-27)29(25-15-7-3-8-16-25)23-33(36-2,28-21-13-6-14-22-28)24-30(32)26-17-9-4-10-18-26/h3-24H,1-2H3,(H,34,35) |
| InChIKey | GBPLEGANPDOILJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |