C24H27F2NO2 — CID 570936
N-[2-[2-[(2,6-difluorophenyl)methoxy]-4-methylcyclohex-3-en-1-yl]propan-2-yl]benzamide (PubChem CID 570936) has the molecular formula C24H27F2NO2 and a molecular weight of 399.48 g/mol. Its IUPAC name is N-[2-[2-[(2,6-difluorophenyl)methoxy]-4-methylcyclohex-3-en-1-yl]propan-2-yl]benzamide.
| Compound Name | N-[2-[2-[(2,6-difluorophenyl)methoxy]-4-methylcyclohex-3-en-1-yl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 570936 |
| Molecular Formula | C24H27F2NO2 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[2-[2-[(2,6-difluorophenyl)methoxy]-4-methylcyclohex-3-en-1-yl]propan-2-yl]benzamide |
| SMILES | CC1=CC(OCc2c(F)cccc2F)C(C(C)(C)NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H27F2NO2/c1-16-12-13-19(24(2,3)27-23(28)17-8-5-4-6-9-17)22(14-16)29-15-18-20(25)10-7-11-21(18)26/h4-11,14,19,22H,12-13,15H2,1-3H3,(H,27,28) |
| InChIKey | VCZOALSBBZMAMY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|