C17H17F2NO2 — CID 46821055
N-[1-(3,4-difluorophenyl)ethyl]-3-(methoxymethyl)benzamide (PubChem CID 46821055) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-3-(methoxymethyl)benzamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-3-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 46821055 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-3-(methoxymethyl)benzamide |
| SMILES | CC(C1=CC(=C(C=C1)F)F)NC(=O)C2=CC=CC(=C2)COC |
| InChI | InChI=1S/C17H17F2NO2/c1-11(13-6-7-15(18)16(19)9-13)20-17(21)14-5-3-4-12(8-14)10-22-2/h3-9,11H,10H2,1-2H3,(H,20,21) |
| InChIKey | IAGPSHFHVFKVGZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | 367 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |