C21H20F3NO2 — CID 134953084
N-[1-[(3S,5R)-5-(2,4,5-trifluorophenyl)oxolan-3-yl]cyclobutyl]benzamide (PubChem CID 134953084) has the molecular formula C21H20F3NO2 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-[1-[(3S,5R)-5-(2,4,5-trifluorophenyl)oxolan-3-yl]cyclobutyl]benzamide.
| Compound Name | N-[1-[(3S,5R)-5-(2,4,5-trifluorophenyl)oxolan-3-yl]cyclobutyl]benzamide |
|---|---|
| PubChem CID | 134953084 |
| Molecular Formula | C21H20F3NO2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[1-[(3S,5R)-5-(2,4,5-trifluorophenyl)oxolan-3-yl]cyclobutyl]benzamide |
| SMILES | O=C(NC1([C@H]2CO[C@@H](c3cc(F)c(F)cc3F)C2)CCC1)c1ccccc1 |
| InChI | InChI=1S/C21H20F3NO2/c22-16-11-18(24)17(23)10-15(16)19-9-14(12-27-19)21(7-4-8-21)25-20(26)13-5-2-1-3-6-13/h1-3,5-6,10-11,14,19H,4,7-9,12H2,(H,25,26)/t14-,19-/m1/s1 |
| InChIKey | BEMDDMQSTSLQJC-AUUYWEPGSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|