C20H24N4O2S — CID 127300730
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide (PubChem CID 127300730) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 127300730 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)NC2CCN3CCCCC23)s1 |
| InChI | InChI=1S/C20H24N4O2S/c25-19(22-15-11-13-24-12-5-4-8-16(15)24)17-9-10-18(27-17)23-20(26)21-14-6-2-1-3-7-14/h1-3,6-7,9-10,15-16H,4-5,8,11-13H2,(H,22,25)(H2,21,23,26) |
| InChIKey | CNIAODYSDKNLNN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |