C14H20N6O — CID 127354102
1-(1-methylpyrazol-4-yl)-3-(2-pyrazol-1-ylethylamino)piperidin-2-one (PubChem CID 127354102) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-3-(2-pyrazol-1-ylethylamino)piperidin-2-one.
| Compound Name | 1-(1-methylpyrazol-4-yl)-3-(2-pyrazol-1-ylethylamino)piperidin-2-one |
|---|---|
| PubChem CID | 127354102 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-3-(2-pyrazol-1-ylethylamino)piperidin-2-one |
| SMILES | Cn1cc(N2CCCC(NCCn3cccn3)C2=O)cn1 |
| InChI | InChI=1S/C14H20N6O/c1-18-11-12(10-17-18)20-8-2-4-13(14(20)21)15-6-9-19-7-3-5-16-19/h3,5,7,10-11,13,15H,2,4,6,8-9H2,1H3 |
| InChIKey | SCHQRFYMTHFMPQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |