C23H27BrO4 — CID 1274356
2-[(3-bromophenyl)-(4,4-dimethyl-2,6-dioxocyclohexyl)methyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 1274356) has the molecular formula C23H27BrO4 and a molecular weight of 447.37 g/mol. Its IUPAC name is 2-[(3-bromophenyl)-(4,4-dimethyl-2,6-dioxocyclohexyl)methyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(3-bromophenyl)-(4,4-dimethyl-2,6-dioxocyclohexyl)methyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 1274356 |
| Molecular Formula | C23H27BrO4 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[(3-bromophenyl)-(4,4-dimethyl-2,6-dioxocyclohexyl)methyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(c2cccc(Br)c2)C2C(=O)CC(C)(C)CC2=O)C(=O)C1 |
| InChI | InChI=1S/C23H27BrO4/c1-22(2)9-15(25)20(16(26)10-22)19(13-6-5-7-14(24)8-13)21-17(27)11-23(3,4)12-18(21)28/h5-8,19-21H,9-12H2,1-4H3 |
| InChIKey | ICPSUDMZFIOHLE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|