About 2-(4-fluorophenyl)ethyl N-methylcarbamate
2-(4-fluorophenyl)ethyl N-methylcarbamate (PubChem CID 127530181) has the molecular formula C10H12FNO2
and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-(4-fluorophenyl)ethyl N-methylcarbamate.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)ethyl N-methylcarbamate |
| PubChem CID | 127530181 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-(4-fluorophenyl)ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCc1ccc(F)cc1 |
| InChI | InChI=1S/C10H12FNO2/c1-12-10(13)14-7-6-8-2-4-9(11)5-3-8/h2-5H,6-7H2,1H3,(H,12,13) |
| InChIKey | JQXGBEAAUQGLLT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorophenyl)ethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)ethyl N-methylcarbamate?
The IUPAC name of 2-(4-fluorophenyl)ethyl N-methylcarbamate (CID 127530181) is 2-(4-fluorophenyl)ethyl N-methylcarbamate.
What is the SMILES notation for 2-(4-fluorophenyl)ethyl N-methylcarbamate?
The canonical SMILES for 2-(4-fluorophenyl)ethyl N-methylcarbamate is CNC(=O)OCCc1ccc(F)cc1.
What is the InChIKey of 2-(4-fluorophenyl)ethyl N-methylcarbamate?
The InChIKey is JQXGBEAAUQGLLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO2/c1-12-10(13)14-7-6-8-2-4-9(11)5-3-8/h2-5H,6-7H2,1H3,(H,12,13).
What are the key properties of 2-(4-fluorophenyl)ethyl N-methylcarbamate?
2-(4-fluorophenyl)ethyl N-methylcarbamate has a molecular weight of 197.21 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)ethyl N-methylcarbamate is sourced from PubChem (CID 127530181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).