C20H15NO2S — CID 12753576
6,7-dimethyl-3-(2-phenyl-1,3-thiazol-4-yl)chromen-4-one (PubChem CID 12753576) has the molecular formula C20H15NO2S and a molecular weight of 333.41 g/mol. Its IUPAC name is 6,7-dimethyl-3-(2-phenyl-1,3-thiazol-4-yl)chromen-4-one.
| Compound Name | 6,7-dimethyl-3-(2-phenyl-1,3-thiazol-4-yl)chromen-4-one |
|---|---|
| PubChem CID | 12753576 |
| Molecular Formula | C20H15NO2S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 6,7-dimethyl-3-(2-phenyl-1,3-thiazol-4-yl)chromen-4-one |
| SMILES | Cc1cc2occ(-c3csc(-c4ccccc4)n3)c(=O)c2cc1C |
| InChI | InChI=1S/C20H15NO2S/c1-12-8-15-18(9-13(12)2)23-10-16(19(15)22)17-11-24-20(21-17)14-6-4-3-5-7-14/h3-11H,1-2H3 |
| InChIKey | JXOYPFAANZRLSX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |