C24H21N3O3 — CID 12757373
2,4,6-tris(4-methylphenoxy)-1,3,5-triazine (PubChem CID 12757373) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2,4,6-tris(4-methylphenoxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-methylphenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 12757373 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2,4,6-tris(4-methylphenoxy)-1,3,5-triazine |
| SMILES | Cc1ccc(Oc2nc(Oc3ccc(C)cc3)nc(Oc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C24H21N3O3/c1-16-4-10-19(11-5-16)28-22-25-23(29-20-12-6-17(2)7-13-20)27-24(26-22)30-21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | FSEKVXCYYHXUPX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |