C14H23NO — CID 12760904
3-cyclohexyl-1-(3,6-dihydro-2H-pyridin-1-yl)propan-1-one (PubChem CID 12760904) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 3-cyclohexyl-1-(3,6-dihydro-2H-pyridin-1-yl)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 12760904 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3-cyclohexyl-1-(3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
| SMILES | O=C(CCC1CCCCC1)N1CC=CCC1 |
| InChI | InChI=1S/C14H23NO/c16-14(15-11-5-2-6-12-15)10-9-13-7-3-1-4-8-13/h2,5,13H,1,3-4,6-12H2 |
| InChIKey | AMAODOPHCHYYJY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|