C7H12N2O — CID 12762342
2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanol (PubChem CID 12762342) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanol.
| Compound Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 12762342 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanol |
| SMILES | Cc1n[nH]c(C)c1CCO |
| InChI | InChI=1S/C7H12N2O/c1-5-7(3-4-10)6(2)9-8-5/h10H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | HXTNUHPVNBFSDN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |