C15H14O5 — CID 12764218
(E)-3-(6-acetyloxy-3,7-dimethyl-1-benzofuran-5-yl)prop-2-enoic acid (PubChem CID 12764218) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is (E)-3-(6-acetyloxy-3,7-dimethyl-1-benzofuran-5-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(6-acetyloxy-3,7-dimethyl-1-benzofuran-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 12764218 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (E)-3-(6-acetyloxy-3,7-dimethyl-1-benzofuran-5-yl)prop-2-enoic acid |
| SMILES | CC(=O)Oc1c(/C=C/C(=O)O)cc2c(C)coc2c1C |
| InChI | InChI=1S/C15H14O5/c1-8-7-19-15-9(2)14(20-10(3)16)11(6-12(8)15)4-5-13(17)18/h4-7H,1-3H3,(H,17,18)/b5-4+ |
| InChIKey | QCTKLBGXIGMWCR-SNAWJCMRSA-N |
| XLogP | 3.07 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|