C17H31N3O4S — CID 127650721
1-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-3-(1-oxaspiro[5.5]undecan-4-yl)urea (PubChem CID 127650721) has the molecular formula C17H31N3O4S and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-3-(1-oxaspiro[5.5]undecan-4-yl)urea.
| Compound Name | 1-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-3-(1-oxaspiro[5.5]undecan-4-yl)urea |
|---|---|
| PubChem CID | 127650721 |
| Molecular Formula | C17H31N3O4S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-3-(1-oxaspiro[5.5]undecan-4-yl)urea |
| SMILES | CS(=O)(=O)N1CCC[C@@H]1CNC(=O)NC1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C17H31N3O4S/c1-25(22,23)20-10-5-6-15(20)13-18-16(21)19-14-7-11-24-17(12-14)8-3-2-4-9-17/h14-15H,2-13H2,1H3,(H2,18,19,21)/t14?,15-/m1/s1 |
| InChIKey | RINRVWYFVGADNO-YSSOQSIOSA-N |
| XLogP | 1.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |