C19H33N3O2 — CID 98559596
1-[[(3S)-1-cyclopropylpyrrolidin-3-yl]methyl]-3-[(4R)-1-oxaspiro[5.5]undecan-4-yl]urea (PubChem CID 98559596) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[[(3S)-1-cyclopropylpyrrolidin-3-yl]methyl]-3-[(4R)-1-oxaspiro[5.5]undecan-4-yl]urea.
| Compound Name | 1-[[(3S)-1-cyclopropylpyrrolidin-3-yl]methyl]-3-[(4R)-1-oxaspiro[5.5]undecan-4-yl]urea |
|---|---|
| PubChem CID | 98559596 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 1-[[(3S)-1-cyclopropylpyrrolidin-3-yl]methyl]-3-[(4R)-1-oxaspiro[5.5]undecan-4-yl]urea |
| SMILES | O=C(NC[C@@H]1CCN(C2CC2)C1)N[C@@H]1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C19H33N3O2/c23-18(20-13-15-6-10-22(14-15)17-4-5-17)21-16-7-11-24-19(12-16)8-2-1-3-9-19/h15-17H,1-14H2,(H2,20,21,23)/t15-,16+/m0/s1 |
| InChIKey | SFCZKZWBXIPVGB-JKSUJKDBSA-N |
| XLogP | 2.65 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |