C11H14ClNO2S — CID 12769195
S-[(5-chloro-2-methoxyphenyl)methyl] N,N-dimethylcarbamothioate (PubChem CID 12769195) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is S-[(5-chloro-2-methoxyphenyl)methyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[(5-chloro-2-methoxyphenyl)methyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 12769195 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | S-[(5-chloro-2-methoxyphenyl)methyl] N,N-dimethylcarbamothioate |
| SMILES | COc1ccc(Cl)cc1CSC(=O)N(C)C |
| InChI | InChI=1S/C11H14ClNO2S/c1-13(2)11(14)16-7-8-6-9(12)4-5-10(8)15-3/h4-6H,7H2,1-3H3 |
| InChIKey | GSYUIFRAATWADE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|