C13H17N3OS — CID 12769781
1,3-dimethyl-1-(5-propan-2-yl-1,3-benzothiazol-2-yl)urea (PubChem CID 12769781) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 1,3-dimethyl-1-(5-propan-2-yl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1,3-dimethyl-1-(5-propan-2-yl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 12769781 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1,3-dimethyl-1-(5-propan-2-yl-1,3-benzothiazol-2-yl)urea |
| SMILES | CNC(=O)N(C)c1nc2cc(C(C)C)ccc2s1 |
| InChI | InChI=1S/C13H17N3OS/c1-8(2)9-5-6-11-10(7-9)15-13(18-11)16(4)12(17)14-3/h5-8H,1-4H3,(H,14,17) |
| InChIKey | SNBDBEXFQMBBNV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |