C13H15NOS — CID 121277459
3-(5-propan-2-yl-1,3-benzothiazol-2-yl)propanal (PubChem CID 121277459) has the molecular formula C13H15NOS and a molecular weight of 233.34 g/mol. Its IUPAC name is 3-(5-propan-2-yl-1,3-benzothiazol-2-yl)propanal.
| Compound Name | 3-(5-propan-2-yl-1,3-benzothiazol-2-yl)propanal |
|---|---|
| PubChem CID | 121277459 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-(5-propan-2-yl-1,3-benzothiazol-2-yl)propanal |
| SMILES | CC(C)c1ccc2sc(CCC=O)nc2c1 |
| InChI | InChI=1S/C13H15NOS/c1-9(2)10-5-6-12-11(8-10)14-13(16-12)4-3-7-15/h5-9H,3-4H2,1-2H3 |
| InChIKey | FXXJFRQWUIHGDC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|