C6H6Cl5O3P — CID 12769893
1,1-dichloro-2-[chloro(1,1-dichloroprop-1-en-2-yloxy)phosphoryl]oxyprop-1-ene (PubChem CID 12769893) has the molecular formula C6H6Cl5O3P and a molecular weight of 334.35 g/mol. Its IUPAC name is 1,1-dichloro-2-[chloro(1,1-dichloroprop-1-en-2-yloxy)phosphoryl]oxyprop-1-ene.
| Compound Name | 1,1-dichloro-2-[chloro(1,1-dichloroprop-1-en-2-yloxy)phosphoryl]oxyprop-1-ene |
|---|---|
| PubChem CID | 12769893 |
| Molecular Formula | C6H6Cl5O3P |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 331.85 |
| IUPAC Name | 1,1-dichloro-2-[chloro(1,1-dichloroprop-1-en-2-yloxy)phosphoryl]oxyprop-1-ene |
| SMILES | CC(OP(=O)(Cl)OC(C)=C(Cl)Cl)=C(Cl)Cl |
| InChI | InChI=1S/C6H6Cl5O3P/c1-3(5(7)8)13-15(11,12)14-4(2)6(9)10/h1-2H3 |
| InChIKey | FWUZHLWDLHGQJZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|