C10H2F12 — CID 12769960
3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diyne (PubChem CID 12769960) has the molecular formula C10H2F12 and a molecular weight of 350.10 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diyne.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diyne |
|---|---|
| PubChem CID | 12769960 |
| Molecular Formula | C10H2F12 |
| Molecular Weight | 350.10 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodeca-1,9-diyne |
| SMILES | C#CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C#C |
| InChI | InChI=1S/C10H2F12/c1-3-5(11,12)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)4-2/h1-2H |
| InChIKey | AMGOALNXHWUMGS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.10 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|