C9H20N2O — CID 127732557
2-(2,3,4-trimethylpiperazin-1-yl)ethanol (PubChem CID 127732557) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-(2,3,4-trimethylpiperazin-1-yl)ethanol.
| Compound Name | 2-(2,3,4-trimethylpiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 127732557 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 2-(2,3,4-trimethylpiperazin-1-yl)ethanol |
| SMILES | CC1C(C)N(CCO)CCN1C |
| InChI | InChI=1S/C9H20N2O/c1-8-9(2)11(6-7-12)5-4-10(8)3/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | CWXYDNBCKGOWRX-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |