C11H15N3O4 — CID 12774897
2,4-bis(oxolan-2-yl)-1,2,4-triazine-3,5-dione (PubChem CID 12774897) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2,4-bis(oxolan-2-yl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2,4-bis(oxolan-2-yl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12774897 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2,4-bis(oxolan-2-yl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(C2CCCO2)c(=O)n1C1CCCO1 |
| InChI | InChI=1S/C11H15N3O4/c15-8-7-12-14(10-4-2-6-18-10)11(16)13(8)9-3-1-5-17-9/h7,9-10H,1-6H2 |
| InChIKey | VMLXMHFPCQUTJO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |