C12H15FN2O4 — CID 76969882
5-fluoro-1,3-bis[(2S)-oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 76969882) has the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. Its IUPAC name is 5-fluoro-1,3-bis[(2S)-oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1,3-bis[(2S)-oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 76969882 |
| Molecular Formula | C12H15FN2O4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 5-fluoro-1,3-bis[(2S)-oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1c(F)cn([C@@H]2CCCO2)c(=O)n1[C@@H]1CCCO1 |
| InChI | InChI=1S/C12H15FN2O4/c13-8-7-14(9-3-1-5-18-9)12(17)15(11(8)16)10-4-2-6-19-10/h7,9-10H,1-6H2/t9-,10-/m0/s1 |
| InChIKey | FLMBDTNCANYTCP-UWVGGRQHSA-N |
| XLogP | 0.77 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |