C12H15FN2O3S — CID 70585782
5-fluoro-1-(oxolan-2-yl)-3-(thiolan-2-yl)pyrimidine-2,4-dione (PubChem CID 70585782) has the molecular formula C12H15FN2O3S and a molecular weight of 286.33 g/mol. Its IUPAC name is 5-fluoro-1-(oxolan-2-yl)-3-(thiolan-2-yl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(oxolan-2-yl)-3-(thiolan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70585782 |
| Molecular Formula | C12H15FN2O3S |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 5-fluoro-1-(oxolan-2-yl)-3-(thiolan-2-yl)pyrimidine-2,4-dione |
| SMILES | O=c1c(F)cn(C2CCCO2)c(=O)n1C1CCCS1 |
| InChI | InChI=1S/C12H15FN2O3S/c13-8-7-14(9-3-1-5-18-9)12(17)15(11(8)16)10-4-2-6-19-10/h7,9-10H,1-6H2 |
| InChIKey | QHYFYYDCKIQUAL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |