C18H16FN3O3 — CID 17481424
5-fluoro-1-(oxolan-2-yl)-3-(quinolin-2-ylmethyl)pyrimidine-2,4-dione (PubChem CID 17481424) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is 5-fluoro-1-(oxolan-2-yl)-3-(quinolin-2-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(oxolan-2-yl)-3-(quinolin-2-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 17481424 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 5-fluoro-1-(oxolan-2-yl)-3-(quinolin-2-ylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1c(F)cn(C2CCCO2)c(=O)n1Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H16FN3O3/c19-14-11-21(16-6-3-9-25-16)18(24)22(17(14)23)10-13-8-7-12-4-1-2-5-15(12)20-13/h1-2,4-5,7-8,11,16H,3,6,9-10H2 |
| InChIKey | BZQDRHJZTJSXBO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |