C10H11FN2O2 — CID 12782787
3-cyclopropyl-1-(2-fluorophenyl)-1-hydroxyurea (PubChem CID 12782787) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2-fluorophenyl)-1-hydroxyurea.
| Compound Name | 3-cyclopropyl-1-(2-fluorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 12782787 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-cyclopropyl-1-(2-fluorophenyl)-1-hydroxyurea |
| SMILES | O=C(NC1CC1)N(O)c1ccccc1F |
| InChI | InChI=1S/C10H11FN2O2/c11-8-3-1-2-4-9(8)13(15)10(14)12-7-5-6-7/h1-4,7,15H,5-6H2,(H,12,14) |
| InChIKey | MJOHBGWMKMVSSX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|