C11H13FN2S — CID 116508220
3-cyclopropyl-1-(2-fluorophenyl)-1-methylthiourea (PubChem CID 116508220) has the molecular formula C11H13FN2S and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2-fluorophenyl)-1-methylthiourea.
| Compound Name | 3-cyclopropyl-1-(2-fluorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 116508220 |
| Molecular Formula | C11H13FN2S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-cyclopropyl-1-(2-fluorophenyl)-1-methylthiourea |
| SMILES | CN(C(=S)NC1CC1)c1ccccc1F |
| InChI | InChI=1S/C11H13FN2S/c1-14(11(15)13-8-6-7-8)10-5-3-2-4-9(10)12/h2-5,8H,6-7H2,1H3,(H,13,15) |
| InChIKey | BWYOCPPEJFSECO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|