C10H9ClF6O — CID 12783446
2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carbonyl chloride (PubChem CID 12783446) has the molecular formula C10H9ClF6O and a molecular weight of 294.62 g/mol. Its IUPAC name is 2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carbonyl chloride.
| Compound Name | 2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 12783446 |
| Molecular Formula | C10H9ClF6O |
| Molecular Weight | 294.62 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2,2-dimethyl-3-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]cyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)C(C=C(C(F)(F)F)C(F)(F)F)C1C(=O)Cl |
| InChI | InChI=1S/C10H9ClF6O/c1-8(2)4(6(8)7(11)18)3-5(9(12,13)14)10(15,16)17/h3-4,6H,1-2H3 |
| InChIKey | XUUFPIFEEKDLBP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|