C16H20N4O — CID 127842980
N-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 127842980) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | N-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 127842980 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | Cc1nc(NC(=O)CC2CCc3ccccc3C2)n(C)n1 |
| InChI | InChI=1S/C16H20N4O/c1-11-17-16(20(2)19-11)18-15(21)10-12-7-8-13-5-3-4-6-14(13)9-12/h3-6,12H,7-10H2,1-2H3,(H,17,18,19,21) |
| InChIKey | OMZOTQMPJMVUNV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |