C24H25N3O3 — CID 12793397
(Z)-2-(1,2-benzoxazol-3-yl)-3-[2-(4-morpholin-4-ylbutoxy)phenyl]prop-2-enenitrile (PubChem CID 12793397) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-(4-morpholin-4-ylbutoxy)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-(4-morpholin-4-ylbutoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 12793397 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-(4-morpholin-4-ylbutoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1OCCCCN1CCOCC1)c1noc2ccccc12 |
| InChI | InChI=1S/C24H25N3O3/c25-18-20(24-21-8-2-4-10-23(21)30-26-24)17-19-7-1-3-9-22(19)29-14-6-5-11-27-12-15-28-16-13-27/h1-4,7-10,17H,5-6,11-16H2/b20-17+ |
| InChIKey | VVALXNCIAMAKAE-LVZFUZTISA-N |
| XLogP | 4.38 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|