C22H21N3O4 — CID 12793471
(Z)-2-(5-hydroxy-1,2-benzoxazol-3-yl)-3-[2-(2-morpholin-4-ylethoxy)phenyl]prop-2-enenitrile (PubChem CID 12793471) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is (Z)-2-(5-hydroxy-1,2-benzoxazol-3-yl)-3-[2-(2-morpholin-4-ylethoxy)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(5-hydroxy-1,2-benzoxazol-3-yl)-3-[2-(2-morpholin-4-ylethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 12793471 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (Z)-2-(5-hydroxy-1,2-benzoxazol-3-yl)-3-[2-(2-morpholin-4-ylethoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1OCCN1CCOCC1)c1noc2ccc(O)cc12 |
| InChI | InChI=1S/C22H21N3O4/c23-15-17(22-19-14-18(26)5-6-21(19)29-24-22)13-16-3-1-2-4-20(16)28-12-9-25-7-10-27-11-8-25/h1-6,13-14,26H,7-12H2/b17-13+ |
| InChIKey | ZEDTVNKYJCCVPG-GHRIWEEISA-N |
| XLogP | 3.31 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|