C23H24IN3O3 — CID 12793477
(Z)-2-(1,2-benzoxazol-3-yl)-3-[2-[2-(4-methylmorpholin-4-ium-4-yl)ethoxy]phenyl]prop-2-enenitrile iodide (PubChem CID 12793477) has the molecular formula C23H24IN3O3 and a molecular weight of 517.37 g/mol. Its IUPAC name is (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-[2-(4-methylmorpholin-4-ium-4-yl)ethoxy]phenyl]prop-2-enenitrile iodide.
| Compound Name | (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-[2-(4-methylmorpholin-4-ium-4-yl)ethoxy]phenyl]prop-2-enenitrile iodide |
|---|---|
| PubChem CID | 12793477 |
| Molecular Formula | C23H24IN3O3 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-[2-(4-methylmorpholin-4-ium-4-yl)ethoxy]phenyl]prop-2-enenitrile iodide |
| SMILES | C[N+]1(CCOc2ccccc2/C=C(\C#N)c2noc3ccccc23)CCOCC1.[I-] |
| InChI | InChI=1S/C23H24N3O3.HI/c1-26(10-13-27-14-11-26)12-15-28-21-8-4-2-6-18(21)16-19(17-24)23-20-7-3-5-9-22(20)29-25-23;/h2-9,16H,10-15H2,1H3;1H/q+1;/p-1/b19-16+; |
| InChIKey | NQBODXJJKRIEDC-PXMDEAMVSA-M |
| XLogP | 0.75 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|