C19H11ClN2O5 — CID 1279368
7-(4-chlorophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 1279368) has the molecular formula C19H11ClN2O5 and a molecular weight of 382.76 g/mol. Its IUPAC name is 7-(4-chlorophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one.
| Compound Name | 7-(4-chlorophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 1279368 |
| Molecular Formula | C19H11ClN2O5 |
| Molecular Weight | 382.76 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 7-(4-chlorophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | O=C1Nc2ccccc2Oc2cc([N+](=O)[O-])cc(Oc3ccc(Cl)cc3)c21 |
| InChI | InChI=1S/C19H11ClN2O5/c20-11-5-7-13(8-6-11)26-16-9-12(22(24)25)10-17-18(16)19(23)21-14-3-1-2-4-15(14)27-17/h1-10H,(H,21,23) |
| InChIKey | SAPHMWFMICIXKV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.76 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|