C13H8N3O6- — CID 163537989
9-[hydroxy(oxido)amino]-7-nitro-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 163537989) has the molecular formula C13H8N3O6- and a molecular weight of 302.22 g/mol. Its IUPAC name is 9-[hydroxy(oxido)amino]-7-nitro-5H-benzo[b][1,4]benzoxazepin-6-one.
| Compound Name | 9-[hydroxy(oxido)amino]-7-nitro-5H-benzo[b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 163537989 |
| Molecular Formula | C13H8N3O6- |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 9-[hydroxy(oxido)amino]-7-nitro-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | O=C1Nc2ccccc2Oc2cc(N([O-])O)cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C13H8N3O6/c17-13-12-9(16(20)21)5-7(15(18)19)6-11(12)22-10-4-2-1-3-8(10)14-13/h1-6,18H,(H,14,17)/q-1 |
| InChIKey | TXBIFKFMVMYVED-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|