C18H22N6O3 — CID 127944775
N-(3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide (PubChem CID 127944775) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide.
| Compound Name | N-(3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 127944775 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
| SMILES | CCN1CCN(CC(=O)Nc2ccc3nnc(C4CCC4)n3c2)C(=O)C1=O |
| InChI | InChI=1S/C18H22N6O3/c1-2-22-8-9-23(18(27)17(22)26)11-15(25)19-13-6-7-14-20-21-16(24(14)10-13)12-4-3-5-12/h6-7,10,12H,2-5,8-9,11H2,1H3,(H,19,25) |
| InChIKey | CHPKFWGHZVJBHB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|