C23H37NO5 — CID 12796497
(2'S,3'S,5'S,8'S,9'S,10'S,11'E,13'S,14'S)-2'-ethoxy-11'-hydroxyimino-10',13'-dimethylspiro[1,3-dioxolane-2,17'-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-3'-ol (PubChem CID 12796497) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is (2'S,3'S,5'S,8'S,9'S,10'S,11'E,13'S,14'S)-2'-ethoxy-11'-hydroxyimino-10',13'-dimethylspiro[1,3-dioxolane-2,17'-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-3'-ol.
| Compound Name | (2'S,3'S,5'S,8'S,9'S,10'S,11'E,13'S,14'S)-2'-ethoxy-11'-hydroxyimino-10',13'-dimethylspiro[1,3-dioxolane-2,17'-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-3'-ol |
|---|---|
| PubChem CID | 12796497 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | (2'S,3'S,5'S,8'S,9'S,10'S,11'E,13'S,14'S)-2'-ethoxy-11'-hydroxyimino-10',13'-dimethylspiro[1,3-dioxolane-2,17'-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-3'-ol |
| SMILES | CCO[C@H]1C[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2/C(=N/O)C[C@@]2(C)[C@H]3CCC23OCCO3)C[C@@H]1O |
| InChI | InChI=1S/C23H37NO5/c1-4-27-19-13-21(2)14(11-18(19)25)5-6-15-16-7-8-23(28-9-10-29-23)22(16,3)12-17(24-26)20(15)21/h14-16,18-20,25-26H,4-13H2,1-3H3/b24-17+/t14-,15-,16-,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | NIBYBBZAOJEUEG-MPXRZRJWSA-N |
| XLogP | 3.59 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|