C13H20N2O4 — CID 12802303
ethyl 3-(hexylamino)-2,5-dioxopyrrole-1-carboxylate (PubChem CID 12802303) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl 3-(hexylamino)-2,5-dioxopyrrole-1-carboxylate.
| Compound Name | ethyl 3-(hexylamino)-2,5-dioxopyrrole-1-carboxylate |
|---|---|
| PubChem CID | 12802303 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | ethyl 3-(hexylamino)-2,5-dioxopyrrole-1-carboxylate |
| SMILES | CCCCCCNC1=CC(=O)N(C(=O)OCC)C1=O |
| InChI | InChI=1S/C13H20N2O4/c1-3-5-6-7-8-14-10-9-11(16)15(12(10)17)13(18)19-4-2/h9,14H,3-8H2,1-2H3 |
| InChIKey | PLYTYJLQHJLLAC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|