C15H24N2O3 — CID 139748000
3-decyl-2,5-dioxopyrrole-1-carboxamide (PubChem CID 139748000) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-decyl-2,5-dioxopyrrole-1-carboxamide.
| Compound Name | 3-decyl-2,5-dioxopyrrole-1-carboxamide |
|---|---|
| PubChem CID | 139748000 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-decyl-2,5-dioxopyrrole-1-carboxamide |
| SMILES | CCCCCCCCCCC1=CC(=O)N(C(N)=O)C1=O |
| InChI | InChI=1S/C15H24N2O3/c1-2-3-4-5-6-7-8-9-10-12-11-13(18)17(14(12)19)15(16)20/h11H,2-10H2,1H3,(H2,16,20) |
| InChIKey | SDGWSLDHWFADBD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|