C30H40N2O4 — CID 57054989
3-heptyl-1-[[2-[(3-heptyl-2,5-dioxopyrrol-1-yl)methyl]phenyl]methyl]pyrrole-2,5-dione (PubChem CID 57054989) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is 3-heptyl-1-[[2-[(3-heptyl-2,5-dioxopyrrol-1-yl)methyl]phenyl]methyl]pyrrole-2,5-dione.
| Compound Name | 3-heptyl-1-[[2-[(3-heptyl-2,5-dioxopyrrol-1-yl)methyl]phenyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 57054989 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 3-heptyl-1-[[2-[(3-heptyl-2,5-dioxopyrrol-1-yl)methyl]phenyl]methyl]pyrrole-2,5-dione |
| SMILES | CCCCCCCC1=CC(=O)N(Cc2ccccc2CN2C(=O)C=C(CCCCCCC)C2=O)C1=O |
| InChI | InChI=1S/C30H40N2O4/c1-3-5-7-9-11-15-23-19-27(33)31(29(23)35)21-25-17-13-14-18-26(25)22-32-28(34)20-24(30(32)36)16-12-10-8-6-4-2/h13-14,17-20H,3-12,15-16,21-22H2,1-2H3 |
| InChIKey | FSQSFRQRQJDCAV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|