C22H19Cl2F8N3O4S4 — CID 12823222
7-chloro-N-[[7-chloro-8-(1,1,2,2-tetrafluoroethylsulfanyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]-8-(1,1,2,2-tetrafluoroethylsulfanyl)-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 12823222) has the molecular formula C22H19Cl2F8N3O4S4 and a molecular weight of 740.57 g/mol. Its IUPAC name is 7-chloro-N-[[7-chloro-8-(1,1,2,2-tetrafluoroethylsulfanyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]-8-(1,1,2,2-tetrafluoroethylsulfanyl)-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
| Compound Name | 7-chloro-N-[[7-chloro-8-(1,1,2,2-tetrafluoroethylsulfanyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]-8-(1,1,2,2-tetrafluoroethylsulfanyl)-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 12823222 |
| Molecular Formula | C22H19Cl2F8N3O4S4 |
| Molecular Weight | 740.57 g/mol |
| Exact Mass | 738.95 |
| IUPAC Name | 7-chloro-N-[[7-chloro-8-(1,1,2,2-tetrafluoroethylsulfanyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]-8-(1,1,2,2-tetrafluoroethylsulfanyl)-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)N1CCc2ccc(Cl)c(SC(F)(F)C(F)F)c2C1)N1CCc2ccc(Cl)c(SC(F)(F)C(F)F)c2C1 |
| InChI | InChI=1S/C22H19Cl2F8N3O4S4/c23-15-3-1-11-5-7-34(9-13(11)17(15)40-21(29,30)19(25)26)42(36,37)33-43(38,39)35-8-6-12-2-4-16(24)18(14(12)10-35)41-22(31,32)20(27)28/h1-4,19-20,33H,5-10H2 |
| InChIKey | YFVOMCLSZXXYKQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|