C22H18N2O2S2 — CID 12826255
4,6-bis(4-methoxyphenyl)-2-thiophen-2-ylsulfanylpyrimidine (PubChem CID 12826255) has the molecular formula C22H18N2O2S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4,6-bis(4-methoxyphenyl)-2-thiophen-2-ylsulfanylpyrimidine.
| Compound Name | 4,6-bis(4-methoxyphenyl)-2-thiophen-2-ylsulfanylpyrimidine |
|---|---|
| PubChem CID | 12826255 |
| Molecular Formula | C22H18N2O2S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4,6-bis(4-methoxyphenyl)-2-thiophen-2-ylsulfanylpyrimidine |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)nc(Sc3cccs3)n2)cc1 |
| InChI | InChI=1S/C22H18N2O2S2/c1-25-17-9-5-15(6-10-17)19-14-20(16-7-11-18(26-2)12-8-16)24-22(23-19)28-21-4-3-13-27-21/h3-14H,1-2H3 |
| InChIKey | ABLRBOFASOFHCO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |