C7H14LiN — CID 12827164
lithium 2,6-dimethylpiperidin-1-ide (PubChem CID 12827164) has the molecular formula C7H14LiN and a molecular weight of 119.14 g/mol. Its IUPAC name is lithium 2,6-dimethylpiperidin-1-ide.
| Compound Name | lithium 2,6-dimethylpiperidin-1-ide |
|---|---|
| PubChem CID | 12827164 |
| Molecular Formula | C7H14LiN |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.13 |
| IUPAC Name | lithium 2,6-dimethylpiperidin-1-ide |
| SMILES | CC1CCCC(C)[N-]1.[Li+] |
| InChI | InChI=1S/C7H14N.Li/c1-6-4-3-5-7(2)8-6;/h6-7H,3-5H2,1-2H3;/q-1;+1 |
| InChIKey | MDWUHDHTFVQYLZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |