C15H15NO — CID 12827997
1-benzyl-5,6-dihydro-4H-indol-2-one (PubChem CID 12827997) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-benzyl-5,6-dihydro-4H-indol-2-one.
| Compound Name | 1-benzyl-5,6-dihydro-4H-indol-2-one |
|---|---|
| PubChem CID | 12827997 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-benzyl-5,6-dihydro-4H-indol-2-one |
| SMILES | O=C1C=C2CCCC=C2N1Cc1ccccc1 |
| InChI | InChI=1S/C15H15NO/c17-15-10-13-8-4-5-9-14(13)16(15)11-12-6-2-1-3-7-12/h1-3,6-7,9-10H,4-5,8,11H2 |
| InChIKey | ZZBAMXWKYHAFPU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |